C31H41Zr+ — CID 23228926
methanidylbenzene;1,2,3,4,5-pentamethylcyclopentane;zirconium(4+) (PubChem CID 23228926) has the molecular formula C31H41Zr+ and a molecular weight of 504.89 g/mol. Its IUPAC name is methanidylbenzene;1,2,3,4,5-pentamethylcyclopentane;zirconium(4+).
| Compound Name | methanidylbenzene;1,2,3,4,5-pentamethylcyclopentane;zirconium(4+) |
|---|---|
| PubChem CID | 23228926 |
| Molecular Formula | C31H41Zr+ |
| Molecular Weight | 504.89 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | methanidylbenzene;1,2,3,4,5-pentamethylcyclopentane;zirconium(4+) |
| SMILES | CC1C(C)C(C)C(C)C1C.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[CH2-]c1ccccc1.[Zr+4] |
| InChI | InChI=1S/C10H20.3C7H7.Zr/c1-6-7(2)9(4)10(5)8(6)3;3*1-7-5-3-2-4-6-7;/h6-10H,1-5H3;3*2-6H,1H2;/q;3*-1;+4 |
| InChIKey | JBYSKQHXPSJLAH-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.89 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|