C26H36O10 — CID 23228927
[(1S,2R,3R,4R,7S,8E,12S,13S,14S)-12,14-diacetyloxy-2,3-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-9-yl]methyl acetate (PubChem CID 23228927) has the molecular formula C26H36O10 and a molecular weight of 508.56 g/mol. Its IUPAC name is [(1S,2R,3R,4R,7S,8E,12S,13S,14S)-12,14-diacetyloxy-2,3-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-9-yl]methyl acetate.
| Compound Name | [(1S,2R,3R,4R,7S,8E,12S,13S,14S)-12,14-diacetyloxy-2,3-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-9-yl]methyl acetate |
|---|---|
| PubChem CID | 23228927 |
| Molecular Formula | C26H36O10 |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | [(1S,2R,3R,4R,7S,8E,12S,13S,14S)-12,14-diacetyloxy-2,3-dihydroxy-4,13,17-trimethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-8,16-dien-9-yl]methyl acetate |
| SMILES | CC(=O)OC/C1=C/[C@@H]2OC(=O)[C@H](C)[C@@]2(O)[C@H](O)[C@H]2C(C)=CC[C@H](OC(C)=O)[C@]2(C)[C@@H](OC(C)=O)CC1 |
| InChI | InChI=1S/C26H36O10/c1-13-7-9-19(34-16(4)28)25(6)20(35-17(5)29)10-8-18(12-33-15(3)27)11-21-26(32,23(30)22(13)25)14(2)24(31)36-21/h7,11,14,19-23,30,32H,8-10,12H2,1-6H3/b18-11+/t14-,19-,20-,21-,22+,23+,25+,26-/m0/s1 |
| InChIKey | NBOFCORDFBBJHP-LPZJBTQWSA-N |
| XLogP | 1.76 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|