C12H17IO2 — CID 23229324
methyl (3R,7R)-5-iodo-3,7-dimethyltricyclo[3.3.0.03,7]octane-1-carboxylate (PubChem CID 23229324) has the molecular formula C12H17IO2 and a molecular weight of 320.17 g/mol. Its IUPAC name is methyl (3R,7R)-5-iodo-3,7-dimethyltricyclo[3.3.0.03,7]octane-1-carboxylate.
| Compound Name | methyl (3R,7R)-5-iodo-3,7-dimethyltricyclo[3.3.0.03,7]octane-1-carboxylate |
|---|---|
| PubChem CID | 23229324 |
| Molecular Formula | C12H17IO2 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | methyl (3R,7R)-5-iodo-3,7-dimethyltricyclo[3.3.0.03,7]octane-1-carboxylate |
| SMILES | COC(=O)C12C[C@]3(C)CC1(I)C[C@@]3(C)C2 |
| InChI | InChI=1S/C12H17IO2/c1-9-4-11(8(14)15-3)5-10(9,2)7-12(11,13)6-9/h4-7H2,1-3H3/t9-,10-,11?,12?/m1/s1 |
| InChIKey | DICPFJWVRSIJBH-QYNFOATHSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|