C24H36O4Si — CID 23229348
[(1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-yl] acetate (PubChem CID 23229348) has the molecular formula C24H36O4Si and a molecular weight of 416.63 g/mol. Its IUPAC name is [(1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-yl] acetate.
| Compound Name | [(1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-yl] acetate |
|---|---|
| PubChem CID | 23229348 |
| Molecular Formula | C24H36O4Si |
| Molecular Weight | 416.63 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [(1R,6S,7R,9R)-7-[dimethyl(phenyl)silyl]-3,3-dimethyl-2,4-dioxatricyclo[4.4.4.01,6]tetradecan-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H]([Si](C)(C)c2ccccc2)[C@]23CCCC[C@]2(C1)OC(C)(C)OC3 |
| InChI | InChI=1S/C24H36O4Si/c1-18(25)27-19-15-21(29(4,5)20-11-7-6-8-12-20)23-13-9-10-14-24(23,16-19)28-22(2,3)26-17-23/h6-8,11-12,19,21H,9-10,13-17H2,1-5H3/t19-,21+,23+,24+/m0/s1 |
| InChIKey | VSCAUEOQHDHSMH-IVGWJTKZSA-N |
| XLogP | 4.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.63 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|