C21H42NSiTi+ — CID 23229458
tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;(Z)-2,3-dimethanidylbut-2-ene;titanium(4+) (PubChem CID 23229458) has the molecular formula C21H42NSiTi+ and a molecular weight of 384.53 g/mol. Its IUPAC name is tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;(Z)-2,3-dimethanidylbut-2-ene;titanium(4+).
| Compound Name | tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;(Z)-2,3-dimethanidylbut-2-ene;titanium(4+) |
|---|---|
| PubChem CID | 23229458 |
| Molecular Formula | C21H42NSiTi+ |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | tert-butyl-[dimethyl-(2,3,4,5-tetramethylcyclopentyl)silyl]azanide;(Z)-2,3-dimethanidylbut-2-ene;titanium(4+) |
| SMILES | CC1C(C)C(C)C([Si](C)(C)[N-]C(C)(C)C)C1C.[CH2-]/C(C)=C(\[CH2-])C.[Ti+4] |
| InChI | InChI=1S/C15H32NSi.C6H10.Ti/c1-10-11(2)13(4)14(12(10)3)17(8,9)16-15(5,6)7;1-5(2)6(3)4;/h10-14H,1-9H3;1,3H2,2,4H3;/q-1;-2;+4/b;6-5-; |
| InChIKey | NUHYYOSTGPVLRK-XRPAZMCKSA-N |
| XLogP | 7.28 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|