C13H13ClN2 — CID 2323002
3-chloro-2-phenyl-4,5,6,7-tetrahydroindazole (PubChem CID 2323002) has the molecular formula C13H13ClN2 and a molecular weight of 232.71 g/mol. Its IUPAC name is 3-chloro-2-phenyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-chloro-2-phenyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 2323002 |
| Molecular Formula | C13H13ClN2 |
| Molecular Weight | 232.71 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 3-chloro-2-phenyl-4,5,6,7-tetrahydroindazole |
| SMILES | Clc1c2c(nn1-c1ccccc1)CCCC2 |
| InChI | InChI=1S/C13H13ClN2/c14-13-11-8-4-5-9-12(11)15-16(13)10-6-2-1-3-7-10/h1-3,6-7H,4-5,8-9H2 |
| InChIKey | XRLBCYHQJCTCTI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.71 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |