About cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate
cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate (PubChem CID 23230282) has the molecular formula C10H16CoO2S2+
and a molecular weight of 291.30 g/mol. Its IUPAC name is cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate.
Molecular Properties
| Compound Name | cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate |
| PubChem CID | 23230282 |
| Molecular Formula | C10H16CoO2S2+ |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate |
| SMILES | C1CCCC1.[CH2-]S/C(=C\[S-])C(=O)OC.[Co+3] |
| InChI | InChI=1S/C5H7O2S2.C5H10.Co/c1-7-5(6)4(3-8)9-2;1-2-4-5-3-1;/h3,8H,2H2,1H3;1-5H2;/q-1;;+3/p-1/b4-3-;; |
| InChIKey | PKNAHWIQRGDKQY-GSBNXNDCSA-M |
| XLogP | 3.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate?
The IUPAC name of cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate (CID 23230282) is cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate.
What is the SMILES notation for cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate?
The canonical SMILES for cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate is C1CCCC1.[CH2-]S/C(=C\[S-])C(=O)OC.[Co+3].
What is the InChIKey of cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate?
The InChIKey is PKNAHWIQRGDKQY-GSBNXNDCSA-M. The full InChI is InChI=1S/C5H7O2S2.C5H10.Co/c1-7-5(6)4(3-8)9-2;1-2-4-5-3-1;/h3,8H,2H2,1H3;1-5H2;/q-1;;+3/p-1/b4-3-;;.
What are the key properties of cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate?
cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate has a molecular weight of 291.30 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cobalt(3+);cyclopentane;(Z)-2-methanidylsulfanyl-3-methoxy-3-oxoprop-1-ene-1-thiolate is sourced from PubChem (CID 23230282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).