About bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+)
bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) (PubChem CID 23231490) has the molecular formula C26H34Ti+2
and a molecular weight of 394.42 g/mol. Its IUPAC name is bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+).
Molecular Properties
| Compound Name | bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) |
| PubChem CID | 23231490 |
| Molecular Formula | C26H34Ti+2 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) |
| SMILES | C1CCCC1.C1CCCC1.[CH2-]C/C(=[C-]/c1ccccc1)c1ccccc1.[Ti+4] |
| InChI | InChI=1S/C16H14.2C5H10.Ti/c1-2-15(16-11-7-4-8-12-16)13-14-9-5-3-6-10-14;2*1-2-4-5-3-1;/h3-12H,1-2H2;2*1-5H2;/q-2;;;+4 |
| InChIKey | ZNKMKFVNXBRMSL-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+)?
The IUPAC name of bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) (CID 23231490) is bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+).
What is the SMILES notation for bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+)?
The canonical SMILES for bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) is C1CCCC1.C1CCCC1.[CH2-]C/C(=[C-]/c1ccccc1)c1ccccc1.[Ti+4].
What is the InChIKey of bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+)?
The InChIKey is ZNKMKFVNXBRMSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14.2C5H10.Ti/c1-2-15(16-11-7-4-8-12-16)13-14-9-5-3-6-10-14;2*1-2-4-5-3-1;/h3-12H,1-2H2;2*1-5H2;/q-2;;;+4.
What are the key properties of bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+)?
bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) has a molecular weight of 394.42 g/mol, XLogP of 8.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(cyclopentane);1-phenylbut-1-en-2-ylbenzene;titanium(4+) is sourced from PubChem (CID 23231490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).