C20H23NO6S — CID 23233071
[(1R,2S,3S,4R,5S)-2-(benzylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate (PubChem CID 23233071) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S)-2-(benzylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,2S,3S,4R,5S)-2-(benzylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 23233071 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | [(1R,2S,3S,4R,5S)-2-(benzylamino)-3-hydroxy-6,8-dioxabicyclo[3.2.1]octan-4-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@H]3OC[C@H](O3)[C@@H](NCc3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C20H23NO6S/c1-13-7-9-15(10-8-13)28(23,24)27-19-18(22)17(16-12-25-20(19)26-16)21-11-14-5-3-2-4-6-14/h2-10,16-22H,11-12H2,1H3/t16-,17+,18-,19+,20-/m0/s1 |
| InChIKey | ISOWYHFJOWRFEB-YHDCXSKOSA-N |
| XLogP | 1.34 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|