C9H11F7 — CID 23233287
1,1,1,2,3,3,3-heptafluoropropan-2-ylcyclohexane (PubChem CID 23233287) has the molecular formula C9H11F7 and a molecular weight of 252.17 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoropropan-2-ylcyclohexane.
| Compound Name | 1,1,1,2,3,3,3-heptafluoropropan-2-ylcyclohexane |
|---|---|
| PubChem CID | 23233287 |
| Molecular Formula | C9H11F7 |
| Molecular Weight | 252.17 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoropropan-2-ylcyclohexane |
| SMILES | FC(F)(F)C(F)(C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F7/c10-7(8(11,12)13,9(14,15)16)6-4-2-1-3-5-6/h6H,1-5H2 |
| InChIKey | WLDCNQNAELPYKA-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |