C3HCl2F4N — CID 23233318
1,3-dichloro-1,1,3,3-tetrafluoropropan-2-imine (PubChem CID 23233318) has the molecular formula C3HCl2F4N and a molecular weight of 197.95 g/mol. Its IUPAC name is 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-imine.
| Compound Name | 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-imine |
|---|---|
| PubChem CID | 23233318 |
| Molecular Formula | C3HCl2F4N |
| Molecular Weight | 197.95 g/mol |
| Exact Mass | 196.94 |
| IUPAC Name | 1,3-dichloro-1,1,3,3-tetrafluoropropan-2-imine |
| SMILES | [H]N=C(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C3HCl2F4N/c4-2(6,7)1(10)3(5,8)9/h10H |
| InChIKey | GLRBCSDWYJVMQR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.95 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|