C4H5F6O+ — CID 23233493
(1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxidanium (PubChem CID 23233493) has the molecular formula C4H5F6O+ and a molecular weight of 183.07 g/mol. Its IUPAC name is (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxidanium.
| Compound Name | (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxidanium |
|---|---|
| PubChem CID | 23233493 |
| Molecular Formula | C4H5F6O+ |
| Molecular Weight | 183.07 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | (1,1,1,3,3,3-hexafluoro-2-methylpropan-2-yl)oxidanium |
| SMILES | CC([OH2+])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O/c1-2(11,3(5,6)7)4(8,9)10/h11H,1H3/p+1 |
| InChIKey | FQDXJYBXPOMIBX-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 22.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.07 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|