C10H10F6O2 — CID 23233588
3,3,3-trifluoro-1,1-bis(prop-2-enoxy)-2-(trifluoromethyl)prop-1-ene (PubChem CID 23233588) has the molecular formula C10H10F6O2 and a molecular weight of 276.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-1,1-bis(prop-2-enoxy)-2-(trifluoromethyl)prop-1-ene.
| Compound Name | 3,3,3-trifluoro-1,1-bis(prop-2-enoxy)-2-(trifluoromethyl)prop-1-ene |
|---|---|
| PubChem CID | 23233588 |
| Molecular Formula | C10H10F6O2 |
| Molecular Weight | 276.18 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3,3,3-trifluoro-1,1-bis(prop-2-enoxy)-2-(trifluoromethyl)prop-1-ene |
| SMILES | C=CCOC(OCC=C)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10F6O2/c1-3-5-17-8(18-6-4-2)7(9(11,12)13)10(14,15)16/h3-4H,1-2,5-6H2 |
| InChIKey | OXEXZRWTRZNYDX-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|