About N-ethyl-1,1-difluoromethanimine
N-ethyl-1,1-difluoromethanimine (PubChem CID 23233688) has the molecular formula C3H5F2N
and a molecular weight of 93.08 g/mol. Its IUPAC name is N-ethyl-1,1-difluoromethanimine.
Molecular Properties
| Compound Name | N-ethyl-1,1-difluoromethanimine |
| PubChem CID | 23233688 |
| Molecular Formula | C3H5F2N |
| Molecular Weight | 93.08 g/mol |
| Exact Mass | 93.04 |
| IUPAC Name | N-ethyl-1,1-difluoromethanimine |
| SMILES | CCN=C(F)F |
| InChI | InChI=1S/C3H5F2N/c1-2-6-3(4)5/h2H2,1H3 |
| InChIKey | UEJJHESIAFBUAS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 93.08 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1,1-difluoromethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,1-difluoromethanimine?
The IUPAC name of N-ethyl-1,1-difluoromethanimine (CID 23233688) is N-ethyl-1,1-difluoromethanimine.
What is the SMILES notation for N-ethyl-1,1-difluoromethanimine?
The canonical SMILES for N-ethyl-1,1-difluoromethanimine is CCN=C(F)F.
What is the InChIKey of N-ethyl-1,1-difluoromethanimine?
The InChIKey is UEJJHESIAFBUAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5F2N/c1-2-6-3(4)5/h2H2,1H3.
What are the key properties of N-ethyl-1,1-difluoromethanimine?
N-ethyl-1,1-difluoromethanimine has a molecular weight of 93.08 g/mol, XLogP of 1.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,1-difluoromethanimine is sourced from PubChem (CID 23233688), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).