C6H10ClF — CID 23233710
cis-(1R,3R)-1-chloro-1-fluoro-2,2,3-trimethylcyclopropane (PubChem CID 23233710) has the molecular formula C6H10ClF and a molecular weight of 136.60 g/mol. Its IUPAC name is cis-(1R,3R)-1-chloro-1-fluoro-2,2,3-trimethylcyclopropane.
| Compound Name | cis-(1R,3R)-1-chloro-1-fluoro-2,2,3-trimethylcyclopropane |
|---|---|
| PubChem CID | 23233710 |
| Molecular Formula | C6H10ClF |
| Molecular Weight | 136.60 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | cis-(1R,3R)-1-chloro-1-fluoro-2,2,3-trimethylcyclopropane |
| SMILES | C[C@@H]1C(C)(C)[C@]1(F)Cl |
| InChI | InChI=1S/C6H10ClF/c1-4-5(2,3)6(4,7)8/h4H,1-3H3/t4-,6+/m1/s1 |
| InChIKey | XJQAIZCWBSHMNU-XINAWCOVSA-N |
| XLogP | 2.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.60 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|