C6H2F10 — CID 23233742
1,1,2,2,3,3,4,5,5,6-decafluorocyclohexane (PubChem CID 23233742) has the molecular formula C6H2F10 and a molecular weight of 264.06 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,5,6-decafluorocyclohexane.
| Compound Name | 1,1,2,2,3,3,4,5,5,6-decafluorocyclohexane |
|---|---|
| PubChem CID | 23233742 |
| Molecular Formula | C6H2F10 |
| Molecular Weight | 264.06 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 1,1,2,2,3,3,4,5,5,6-decafluorocyclohexane |
| SMILES | FC1C(F)(F)C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C6H2F10/c7-1-3(9,10)2(8)5(13,14)6(15,16)4(1,11)12/h1-2H |
| InChIKey | AJDNXBZBICTRBB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.06 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|