C14H6F10NP — CID 23233872
N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-methylmethanamine (PubChem CID 23233872) has the molecular formula C14H6F10NP and a molecular weight of 409.16 g/mol. Its IUPAC name is N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-methylmethanamine.
| Compound Name | N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-methylmethanamine |
|---|---|
| PubChem CID | 23233872 |
| Molecular Formula | C14H6F10NP |
| Molecular Weight | 409.16 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | N-bis(2,3,4,5,6-pentafluorophenyl)phosphanyl-N-methylmethanamine |
| SMILES | CN(C)P(c1c(F)c(F)c(F)c(F)c1F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H6F10NP/c1-25(2)26(13-9(21)5(17)3(15)6(18)10(13)22)14-11(23)7(19)4(16)8(20)12(14)24/h1-2H3 |
| InChIKey | UTGVWHXITYZTEO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.16 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|