About 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one
3,5-dichloro-4,6-difluoro-1H-pyridin-2-one (PubChem CID 23233896) has the molecular formula C5HCl2F2NO
and a molecular weight of 199.97 g/mol. Its IUPAC name is 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one |
| PubChem CID | 23233896 |
| Molecular Formula | C5HCl2F2NO |
| Molecular Weight | 199.97 g/mol |
| Exact Mass | 198.94 |
| IUPAC Name | 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one |
| SMILES | O=c1[nH]c(F)c(Cl)c(F)c1Cl |
| InChI | InChI=1S/C5HCl2F2NO/c6-1-3(8)2(7)5(11)10-4(1)9/h(H,10,11) |
| InChIKey | YUTXVCJAQKCFFV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.97 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one?
The IUPAC name of 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one (CID 23233896) is 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one.
What is the SMILES notation for 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one?
The canonical SMILES for 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one is O=c1[nH]c(F)c(Cl)c(F)c1Cl.
What is the InChIKey of 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one?
The InChIKey is YUTXVCJAQKCFFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5HCl2F2NO/c6-1-3(8)2(7)5(11)10-4(1)9/h(H,10,11).
What are the key properties of 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one?
3,5-dichloro-4,6-difluoro-1H-pyridin-2-one has a molecular weight of 199.97 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4,6-difluoro-1H-pyridin-2-one is sourced from PubChem (CID 23233896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).