About 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile
2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile (PubChem CID 2323406) has the molecular formula C11H8N4
and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile |
| PubChem CID | 2323406 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile |
| SMILES | N#CCc1nc2n(n1)Cc1ccccc1-2 |
| InChI | InChI=1S/C11H8N4/c12-6-5-10-13-11-9-4-2-1-3-8(9)7-15(11)14-10/h1-4H,5,7H2 |
| InChIKey | MIYAUJIAWMBKQK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile?
The IUPAC name of 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile (CID 2323406) is 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile.
What is the SMILES notation for 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile?
The canonical SMILES for 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile is N#CCc1nc2n(n1)Cc1ccccc1-2.
What is the InChIKey of 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile?
The InChIKey is MIYAUJIAWMBKQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4/c12-6-5-10-13-11-9-4-2-1-3-8(9)7-15(11)14-10/h1-4H,5,7H2.
What are the key properties of 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile?
2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile has a molecular weight of 196.21 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5H-[1,2,4]triazolo[5,1-a]isoindol-2-yl)acetonitrile is sourced from PubChem (CID 2323406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).