About 1-fluoro-2-methylpentane
1-fluoro-2-methylpentane (PubChem CID 23234143) has the molecular formula C6H13F
and a molecular weight of 104.17 g/mol. Its IUPAC name is 1-fluoro-2-methylpentane.
Molecular Properties
| Compound Name | 1-fluoro-2-methylpentane |
| PubChem CID | 23234143 |
| Molecular Formula | C6H13F |
| Molecular Weight | 104.17 g/mol |
| Exact Mass | 104.10 |
| IUPAC Name | 1-fluoro-2-methylpentane |
| SMILES | CCCC(C)CF |
| InChI | InChI=1S/C6H13F/c1-3-4-6(2)5-7/h6H,3-5H2,1-2H3 |
| InChIKey | ZXIWYFCHHRVWOX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.17 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-2-methylpentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methylpentane?
The IUPAC name of 1-fluoro-2-methylpentane (CID 23234143) is 1-fluoro-2-methylpentane.
What is the SMILES notation for 1-fluoro-2-methylpentane?
The canonical SMILES for 1-fluoro-2-methylpentane is CCCC(C)CF.
What is the InChIKey of 1-fluoro-2-methylpentane?
The InChIKey is ZXIWYFCHHRVWOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13F/c1-3-4-6(2)5-7/h6H,3-5H2,1-2H3.
What are the key properties of 1-fluoro-2-methylpentane?
1-fluoro-2-methylpentane has a molecular weight of 104.17 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methylpentane is sourced from PubChem (CID 23234143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).