C6H9BrClF — CID 23234314
(1S,2S,3S)-1-(bromomethyl)-2-chloro-2-fluoro-1,3-dimethylcyclopropane (PubChem CID 23234314) has the molecular formula C6H9BrClF and a molecular weight of 215.49 g/mol. Its IUPAC name is (1S,2S,3S)-1-(bromomethyl)-2-chloro-2-fluoro-1,3-dimethylcyclopropane.
| Compound Name | (1S,2S,3S)-1-(bromomethyl)-2-chloro-2-fluoro-1,3-dimethylcyclopropane |
|---|---|
| PubChem CID | 23234314 |
| Molecular Formula | C6H9BrClF |
| Molecular Weight | 215.49 g/mol |
| Exact Mass | 213.96 |
| IUPAC Name | (1S,2S,3S)-1-(bromomethyl)-2-chloro-2-fluoro-1,3-dimethylcyclopropane |
| SMILES | C[C@@H]1[C@](F)(Cl)[C@@]1(C)CBr |
| InChI | InChI=1S/C6H9BrClF/c1-4-5(2,3-7)6(4,8)9/h4H,3H2,1-2H3/t4-,5-,6+/m0/s1 |
| InChIKey | ZRYZEZFYYZWUJJ-HCWXCVPCSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.49 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|