C6H10ClFO — CID 23234318
[(1R,2S,3S)-2-chloro-2-fluoro-1,3-dimethylcyclopropyl]methanol (PubChem CID 23234318) has the molecular formula C6H10ClFO and a molecular weight of 152.60 g/mol. Its IUPAC name is [(1R,2S,3S)-2-chloro-2-fluoro-1,3-dimethylcyclopropyl]methanol.
| Compound Name | [(1R,2S,3S)-2-chloro-2-fluoro-1,3-dimethylcyclopropyl]methanol |
|---|---|
| PubChem CID | 23234318 |
| Molecular Formula | C6H10ClFO |
| Molecular Weight | 152.60 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | [(1R,2S,3S)-2-chloro-2-fluoro-1,3-dimethylcyclopropyl]methanol |
| SMILES | C[C@@H]1[C@](F)(Cl)[C@@]1(C)CO |
| InChI | InChI=1S/C6H10ClFO/c1-4-5(2,3-9)6(4,7)8/h4,9H,3H2,1-2H3/t4-,5-,6+/m0/s1 |
| InChIKey | ZHVTWJMOKSMBNC-HCWXCVPCSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.60 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|