C6H8F4 — CID 23234325
(1R,2R,3S,4S)-1,2,3,4-tetrafluorocyclohexane (PubChem CID 23234325) has the molecular formula C6H8F4 and a molecular weight of 156.12 g/mol. Its IUPAC name is (1R,2R,3S,4S)-1,2,3,4-tetrafluorocyclohexane.
| Compound Name | (1R,2R,3S,4S)-1,2,3,4-tetrafluorocyclohexane |
|---|---|
| PubChem CID | 23234325 |
| Molecular Formula | C6H8F4 |
| Molecular Weight | 156.12 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (1R,2R,3S,4S)-1,2,3,4-tetrafluorocyclohexane |
| SMILES | F[C@@H]1[C@H](F)[C@H](F)CC[C@@H]1F |
| InChI | InChI=1S/C6H8F4/c7-3-1-2-4(8)6(10)5(3)9/h3-6H,1-2H2/t3-,4+,5-,6+ |
| InChIKey | OXEMDXFZNSLHBB-FBXFSONDSA-N |
| XLogP | 2.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |