C9HF7 — CID 23234372
1,1,2,4,5,6,7-heptafluoroindene (PubChem CID 23234372) has the molecular formula C9HF7 and a molecular weight of 242.09 g/mol. Its IUPAC name is 1,1,2,4,5,6,7-heptafluoroindene.
| Compound Name | 1,1,2,4,5,6,7-heptafluoroindene |
|---|---|
| PubChem CID | 23234372 |
| Molecular Formula | C9HF7 |
| Molecular Weight | 242.09 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 1,1,2,4,5,6,7-heptafluoroindene |
| SMILES | FC1=Cc2c(F)c(F)c(F)c(F)c2C1(F)F |
| InChI | InChI=1S/C9HF7/c10-3-1-2-4(9(3,15)16)6(12)8(14)7(13)5(2)11/h1H |
| InChIKey | PSARHBCDFOQZAF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.09 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|