C10H10F2O — CID 23234484
(1R,3R)-4,7-difluoro-3-methyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 23234484) has the molecular formula C10H10F2O and a molecular weight of 184.19 g/mol. Its IUPAC name is (1R,3R)-4,7-difluoro-3-methyl-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,3R)-4,7-difluoro-3-methyl-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 23234484 |
| Molecular Formula | C10H10F2O |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | (1R,3R)-4,7-difluoro-3-methyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | C[C@@H]1C[C@@H](O)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C10H10F2O/c1-5-4-8(13)10-7(12)3-2-6(11)9(5)10/h2-3,5,8,13H,4H2,1H3/t5-,8-/m1/s1 |
| InChIKey | VLNCFEDGTSGRLG-SVGQVSJJSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |