About 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile
1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile (PubChem CID 23234671) has the molecular formula C10H12F6N2
and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile.
Molecular Properties
| Compound Name | 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile |
| PubChem CID | 23234671 |
| Molecular Formula | C10H12F6N2 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile |
| SMILES | CC(C)(C)N1CC(F)(C(F)(F)F)C(F)(F)C1C#N |
| InChI | InChI=1S/C10H12F6N2/c1-7(2,3)18-5-8(11,10(14,15)16)9(12,13)6(18)4-17/h6H,5H2,1-3H3 |
| InChIKey | DELTWKXKINEREF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile?
The IUPAC name of 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile (CID 23234671) is 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile.
What is the SMILES notation for 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile?
The canonical SMILES for 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile is CC(C)(C)N1CC(F)(C(F)(F)F)C(F)(F)C1C#N.
What is the InChIKey of 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile?
The InChIKey is DELTWKXKINEREF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F6N2/c1-7(2,3)18-5-8(11,10(14,15)16)9(12,13)6(18)4-17/h6H,5H2,1-3H3.
What are the key properties of 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile?
1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile has a molecular weight of 274.21 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carbonitrile is sourced from PubChem (CID 23234671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).