C4H3F6N — CID 23234712
1,1,1,4,4,4-hexafluorobutan-2-imine (PubChem CID 23234712) has the molecular formula C4H3F6N and a molecular weight of 179.06 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutan-2-imine.
| Compound Name | 1,1,1,4,4,4-hexafluorobutan-2-imine |
|---|---|
| PubChem CID | 23234712 |
| Molecular Formula | C4H3F6N |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutan-2-imine |
| SMILES | [H]/N=C(\CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H3F6N/c5-3(6,7)1-2(11)4(8,9)10/h11H,1H2/b11-2+ |
| InChIKey | GIWFHIMGFPIOLT-BIIKFXOESA-N |
| XLogP | 2.52 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|