C4H2F7N — CID 23234713
1,1,1,3,4,4,4-heptafluorobutan-2-imine (PubChem CID 23234713) has the molecular formula C4H2F7N and a molecular weight of 197.05 g/mol. Its IUPAC name is 1,1,1,3,4,4,4-heptafluorobutan-2-imine.
| Compound Name | 1,1,1,3,4,4,4-heptafluorobutan-2-imine |
|---|---|
| PubChem CID | 23234713 |
| Molecular Formula | C4H2F7N |
| Molecular Weight | 197.05 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 1,1,1,3,4,4,4-heptafluorobutan-2-imine |
| SMILES | [H]/N=C(/C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H2F7N/c5-1(3(6,7)8)2(12)4(9,10)11/h1,12H/b12-2- |
| InChIKey | YSLLZHWHKWLRHF-OIXVIMQBSA-N |
| XLogP | 2.47 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.05 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|