C10H4Cl2F8 — CID 23234781
2,3-bis(chloromethyl)-1,4,5,6,7,7,8,8-octafluorobicyclo[2.2.2]octa-2,5-diene (PubChem CID 23234781) has the molecular formula C10H4Cl2F8 and a molecular weight of 347.03 g/mol. Its IUPAC name is 2,3-bis(chloromethyl)-1,4,5,6,7,7,8,8-octafluorobicyclo[2.2.2]octa-2,5-diene.
| Compound Name | 2,3-bis(chloromethyl)-1,4,5,6,7,7,8,8-octafluorobicyclo[2.2.2]octa-2,5-diene |
|---|---|
| PubChem CID | 23234781 |
| Molecular Formula | C10H4Cl2F8 |
| Molecular Weight | 347.03 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 2,3-bis(chloromethyl)-1,4,5,6,7,7,8,8-octafluorobicyclo[2.2.2]octa-2,5-diene |
| SMILES | FC1=C(F)C2(F)C(CCl)=C(CCl)C1(F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H4Cl2F8/c11-1-3-4(2-12)8(16)6(14)5(13)7(3,15)9(17,18)10(8,19)20/h1-2H2 |
| InChIKey | OGYOYCNLUJQPNB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.03 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|