C8H7F5N2 — CID 23234793
N'-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine (PubChem CID 23234793) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is N'-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine.
| Compound Name | N'-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 23234793 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | N'-(2,3,4,5,6-pentafluorophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C8H7F5N2/c9-3-4(10)6(12)8(15-2-1-14)7(13)5(3)11/h15H,1-2,14H2 |
| InChIKey | WRIPWVIEOBHRAH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|