C4H2F6O — CID 23234832
(3S,4S)-2,2,3,4,5,5-hexafluorooxolane (PubChem CID 23234832) has the molecular formula C4H2F6O and a molecular weight of 180.05 g/mol. Its IUPAC name is (3S,4S)-2,2,3,4,5,5-hexafluorooxolane.
| Compound Name | (3S,4S)-2,2,3,4,5,5-hexafluorooxolane |
|---|---|
| PubChem CID | 23234832 |
| Molecular Formula | C4H2F6O |
| Molecular Weight | 180.05 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | (3S,4S)-2,2,3,4,5,5-hexafluorooxolane |
| SMILES | F[C@H]1[C@H](F)C(F)(F)OC1(F)F |
| InChI | InChI=1S/C4H2F6O/c5-1-2(6)4(9,10)11-3(1,7)8/h1-2H/t1-,2-/m0/s1 |
| InChIKey | LKZYEBCKWAOFPB-LWMBPPNESA-N |
| XLogP | 1.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.05 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |