About methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate
methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate (PubChem CID 23234954) has the molecular formula C11H15F6NO2
and a molecular weight of 307.23 g/mol. Its IUPAC name is methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate |
| PubChem CID | 23234954 |
| Molecular Formula | C11H15F6NO2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1N(C(C)(C)C)CC(F)(C(F)(F)F)C1(F)F |
| InChI | InChI=1S/C11H15F6NO2/c1-8(2,3)18-5-9(12,11(15,16)17)10(13,14)6(18)7(19)20-4/h6H,5H2,1-4H3 |
| InChIKey | PQWZMZOHIVFHEL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate (CID 23234954) is methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate is COC(=O)C1N(C(C)(C)C)CC(F)(C(F)(F)F)C1(F)F.
What is the InChIKey of methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate?
The InChIKey is PQWZMZOHIVFHEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F6NO2/c1-8(2,3)18-5-9(12,11(15,16)17)10(13,14)6(18)7(19)20-4/h6H,5H2,1-4H3.
What are the key properties of methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate?
methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate has a molecular weight of 307.23 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-tert-butyl-3,3,4-trifluoro-4-(trifluoromethyl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 23234954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).