C6F12I2O2 — CID 23235134
[1,1,1,4,4,4-hexafluoro-3-iodooxy-2,3-bis(trifluoromethyl)butan-2-yl] hypoiodite (PubChem CID 23235134) has the molecular formula C6F12I2O2 and a molecular weight of 585.85 g/mol. Its IUPAC name is [1,1,1,4,4,4-hexafluoro-3-iodooxy-2,3-bis(trifluoromethyl)butan-2-yl] hypoiodite.
| Compound Name | [1,1,1,4,4,4-hexafluoro-3-iodooxy-2,3-bis(trifluoromethyl)butan-2-yl] hypoiodite |
|---|---|
| PubChem CID | 23235134 |
| Molecular Formula | C6F12I2O2 |
| Molecular Weight | 585.85 g/mol |
| Exact Mass | 585.78 |
| IUPAC Name | [1,1,1,4,4,4-hexafluoro-3-iodooxy-2,3-bis(trifluoromethyl)butan-2-yl] hypoiodite |
| SMILES | FC(F)(F)C(OI)(C(F)(F)F)C(OI)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F12I2O2/c7-3(8,9)1(21-19,4(10,11)12)2(22-20,5(13,14)15)6(16,17)18 |
| InChIKey | CGGDLUYIGGLKAP-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.85 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|