C8F10 — CID 23235281
1,2,3,4,5-pentafluoro-6-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 23235281) has the molecular formula C8F10 and a molecular weight of 286.07 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 23235281 |
| Molecular Formula | C8F10 |
| Molecular Weight | 286.07 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C8F10/c9-2-1(7(14,15)8(16,17)18)3(10)5(12)6(13)4(2)11 |
| InChIKey | BMFPHHLKGOOCHE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|