C4Br2F4O — CID 23235462
(2S,5R)-2,5-dibromo-2,3,4,5-tetrafluorofuran (PubChem CID 23235462) has the molecular formula C4Br2F4O and a molecular weight of 299.84 g/mol. Its IUPAC name is (2S,5R)-2,5-dibromo-2,3,4,5-tetrafluorofuran.
| Compound Name | (2S,5R)-2,5-dibromo-2,3,4,5-tetrafluorofuran |
|---|---|
| PubChem CID | 23235462 |
| Molecular Formula | C4Br2F4O |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 297.83 |
| IUPAC Name | (2S,5R)-2,5-dibromo-2,3,4,5-tetrafluorofuran |
| SMILES | FC1=C(F)[C@](F)(Br)O[C@]1(F)Br |
| InChI | InChI=1S/C4Br2F4O/c5-3(9)1(7)2(8)4(6,10)11-3/t3-,4+ |
| InChIKey | UAIWFQOTZCIDGO-ZXZARUISSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|