About 1-cyclohexyl-2,2-difluoroethanone
1-cyclohexyl-2,2-difluoroethanone (PubChem CID 23235830) has the molecular formula C8H12F2O
and a molecular weight of 162.18 g/mol. Its IUPAC name is 1-cyclohexyl-2,2-difluoroethanone.
Molecular Properties
| Compound Name | 1-cyclohexyl-2,2-difluoroethanone |
| PubChem CID | 23235830 |
| Molecular Formula | C8H12F2O |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1-cyclohexyl-2,2-difluoroethanone |
| SMILES | O=C(C(F)F)C1CCCCC1 |
| InChI | InChI=1S/C8H12F2O/c9-8(10)7(11)6-4-2-1-3-5-6/h6,8H,1-5H2 |
| InChIKey | XGWUSEIMBHYVAJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-2,2-difluoroethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2,2-difluoroethanone?
The IUPAC name of 1-cyclohexyl-2,2-difluoroethanone (CID 23235830) is 1-cyclohexyl-2,2-difluoroethanone.
What is the SMILES notation for 1-cyclohexyl-2,2-difluoroethanone?
The canonical SMILES for 1-cyclohexyl-2,2-difluoroethanone is O=C(C(F)F)C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2,2-difluoroethanone?
The InChIKey is XGWUSEIMBHYVAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2O/c9-8(10)7(11)6-4-2-1-3-5-6/h6,8H,1-5H2.
What are the key properties of 1-cyclohexyl-2,2-difluoroethanone?
1-cyclohexyl-2,2-difluoroethanone has a molecular weight of 162.18 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2,2-difluoroethanone is sourced from PubChem (CID 23235830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).