C6Cl2F6 — CID 23235859
(1Z,3E,5Z)-1,6-dichloro-1,2,3,4,5,6-hexafluorohexa-1,3,5-triene (PubChem CID 23235859) has the molecular formula C6Cl2F6 and a molecular weight of 256.96 g/mol. Its IUPAC name is (1Z,3E,5Z)-1,6-dichloro-1,2,3,4,5,6-hexafluorohexa-1,3,5-triene.
| Compound Name | (1Z,3E,5Z)-1,6-dichloro-1,2,3,4,5,6-hexafluorohexa-1,3,5-triene |
|---|---|
| PubChem CID | 23235859 |
| Molecular Formula | C6Cl2F6 |
| Molecular Weight | 256.96 g/mol |
| Exact Mass | 255.93 |
| IUPAC Name | (1Z,3E,5Z)-1,6-dichloro-1,2,3,4,5,6-hexafluorohexa-1,3,5-triene |
| SMILES | F/C(Cl)=C(F)\C(F)=C(F)\C(F)=C(/F)Cl |
| InChI | InChI=1S/C6Cl2F6/c7-5(13)3(11)1(9)2(10)4(12)6(8)14/b2-1+,5-3+,6-4+ |
| InChIKey | AXDQUDHOOWDFDE-CRQXNEITSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|