About 1,4,5-trifluoroanthracene
1,4,5-trifluoroanthracene (PubChem CID 23235862) has the molecular formula C14H7F3
and a molecular weight of 232.20 g/mol. Its IUPAC name is 1,4,5-trifluoroanthracene.
Molecular Properties
| Compound Name | 1,4,5-trifluoroanthracene |
| PubChem CID | 23235862 |
| Molecular Formula | C14H7F3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1,4,5-trifluoroanthracene |
| SMILES | Fc1cccc2cc3c(F)ccc(F)c3cc12 |
| InChI | InChI=1S/C14H7F3/c15-12-3-1-2-8-6-10-11(7-9(8)12)14(17)5-4-13(10)16/h1-7H |
| InChIKey | WARVGIGGMVNJJV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1,4,5-trifluoroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,5-trifluoroanthracene?
The IUPAC name of 1,4,5-trifluoroanthracene (CID 23235862) is 1,4,5-trifluoroanthracene.
What is the SMILES notation for 1,4,5-trifluoroanthracene?
The canonical SMILES for 1,4,5-trifluoroanthracene is Fc1cccc2cc3c(F)ccc(F)c3cc12.
What is the InChIKey of 1,4,5-trifluoroanthracene?
The InChIKey is WARVGIGGMVNJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F3/c15-12-3-1-2-8-6-10-11(7-9(8)12)14(17)5-4-13(10)16/h1-7H.
What are the key properties of 1,4,5-trifluoroanthracene?
1,4,5-trifluoroanthracene has a molecular weight of 232.20 g/mol, XLogP of 4.41, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,5-trifluoroanthracene is sourced from PubChem (CID 23235862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).