About (5R)-5-fluoro-1,3-diazinane-2,4-dione
(5R)-5-fluoro-1,3-diazinane-2,4-dione (PubChem CID 23236029) has the molecular formula C4H5FN2O2
and a molecular weight of 132.09 g/mol. Its IUPAC name is (5R)-5-fluoro-1,3-diazinane-2,4-dione.
Molecular Properties
| Compound Name | (5R)-5-fluoro-1,3-diazinane-2,4-dione |
| PubChem CID | 23236029 |
| Molecular Formula | C4H5FN2O2 |
| Molecular Weight | 132.09 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | (5R)-5-fluoro-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC[C@@H](F)C(=O)N1 |
| InChI | InChI=1S/C4H5FN2O2/c5-2-1-6-4(9)7-3(2)8/h2H,1H2,(H2,6,7,8,9)/t2-/m1/s1 |
| InChIKey | RAIRJKWTBBDDAR-UWTATZPHSA-N |
| XLogP | -0.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.09 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-5-fluoro-1,3-diazinane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-fluoro-1,3-diazinane-2,4-dione?
The IUPAC name of (5R)-5-fluoro-1,3-diazinane-2,4-dione (CID 23236029) is (5R)-5-fluoro-1,3-diazinane-2,4-dione.
What is the SMILES notation for (5R)-5-fluoro-1,3-diazinane-2,4-dione?
The canonical SMILES for (5R)-5-fluoro-1,3-diazinane-2,4-dione is O=C1NC[C@@H](F)C(=O)N1.
What is the InChIKey of (5R)-5-fluoro-1,3-diazinane-2,4-dione?
The InChIKey is RAIRJKWTBBDDAR-UWTATZPHSA-N. The full InChI is InChI=1S/C4H5FN2O2/c5-2-1-6-4(9)7-3(2)8/h2H,1H2,(H2,6,7,8,9)/t2-/m1/s1.
What are the key properties of (5R)-5-fluoro-1,3-diazinane-2,4-dione?
(5R)-5-fluoro-1,3-diazinane-2,4-dione has a molecular weight of 132.09 g/mol, XLogP of -0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-fluoro-1,3-diazinane-2,4-dione is sourced from PubChem (CID 23236029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).