C8H9F9 — CID 23236215
1,1,1-trifluoro-2,2-bis(trifluoromethyl)hexane (PubChem CID 23236215) has the molecular formula C8H9F9 and a molecular weight of 276.14 g/mol. Its IUPAC name is 1,1,1-trifluoro-2,2-bis(trifluoromethyl)hexane.
| Compound Name | 1,1,1-trifluoro-2,2-bis(trifluoromethyl)hexane |
|---|---|
| PubChem CID | 23236215 |
| Molecular Formula | C8H9F9 |
| Molecular Weight | 276.14 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 1,1,1-trifluoro-2,2-bis(trifluoromethyl)hexane |
| SMILES | CCCCC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F9/c1-2-3-4-5(6(9,10)11,7(12,13)14)8(15,16)17/h2-4H2,1H3 |
| InChIKey | GAEIEMRXPMGXLB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.14 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |