C4ClF10N — CID 23236265
N-(2-chloro-1,1,2,2-tetrafluoroethyl)-N,1,1,2,2,2-hexafluoroethanamine (PubChem CID 23236265) has the molecular formula C4ClF10N and a molecular weight of 287.48 g/mol. Its IUPAC name is N-(2-chloro-1,1,2,2-tetrafluoroethyl)-N,1,1,2,2,2-hexafluoroethanamine.
| Compound Name | N-(2-chloro-1,1,2,2-tetrafluoroethyl)-N,1,1,2,2,2-hexafluoroethanamine |
|---|---|
| PubChem CID | 23236265 |
| Molecular Formula | C4ClF10N |
| Molecular Weight | 287.48 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | N-(2-chloro-1,1,2,2-tetrafluoroethyl)-N,1,1,2,2,2-hexafluoroethanamine |
| SMILES | FN(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C4ClF10N/c5-1(6,7)3(11,12)16(15)4(13,14)2(8,9)10 |
| InChIKey | XAYHHZGPWSQSQY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|