C7H5F9 — CID 23236402
(E)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pent-2-ene (PubChem CID 23236402) has the molecular formula C7H5F9 and a molecular weight of 260.10 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pent-2-ene.
| Compound Name | (E)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 23236402 |
| Molecular Formula | C7H5F9 |
| Molecular Weight | 260.10 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | (E)-5,5,5-trifluoro-4,4-bis(trifluoromethyl)pent-2-ene |
| SMILES | C/C=C/C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9/c1-2-3-4(5(8,9)10,6(11,12)13)7(14,15)16/h2-3H,1H3/b3-2+ |
| InChIKey | DQEJIVNNBISIKV-NSCUHMNNSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.10 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|