C8H9F7O — CID 23236455
5,5,6,6,7,7,7-heptafluoro-4-methylheptan-3-one (PubChem CID 23236455) has the molecular formula C8H9F7O and a molecular weight of 254.14 g/mol. Its IUPAC name is 5,5,6,6,7,7,7-heptafluoro-4-methylheptan-3-one.
| Compound Name | 5,5,6,6,7,7,7-heptafluoro-4-methylheptan-3-one |
|---|---|
| PubChem CID | 23236455 |
| Molecular Formula | C8H9F7O |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 5,5,6,6,7,7,7-heptafluoro-4-methylheptan-3-one |
| SMILES | CCC(=O)C(C)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F7O/c1-3-5(16)4(2)6(9,10)7(11,12)8(13,14)15/h4H,3H2,1-2H3 |
| InChIKey | QQGCRHKFDHSORV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|