C17H24BrF3O5 — CID 23236595
(1R,4S,5R,8R,9R,10S,12R,13R)-9-bromo-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 23236595) has the molecular formula C17H24BrF3O5 and a molecular weight of 445.27 g/mol. Its IUPAC name is (1R,4S,5R,8R,9R,10S,12R,13R)-9-bromo-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8R,9R,10S,12R,13R)-9-bromo-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 23236595 |
| Molecular Formula | C17H24BrF3O5 |
| Molecular Weight | 445.27 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (1R,4S,5R,8R,9R,10S,12R,13R)-9-bromo-1,5,9-trimethyl-10-(2,2,2-trifluoroethoxy)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@@H]1CC[C@H]2[C@@](C)(Br)[C@@H](OCC(F)(F)F)O[C@@H]3O[C@@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C17H24BrF3O5/c1-9-4-5-11-15(3,18)12(22-8-16(19,20)21)23-13-17(11)10(9)6-7-14(2,24-13)25-26-17/h9-13H,4-8H2,1-3H3/t9-,10+,11+,12+,13-,14-,15-,17-/m1/s1 |
| InChIKey | SQMSWUQXSDEFAQ-NVBIBLTLSA-N |
| XLogP | 4.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|