C8H8F9NO4S — CID 23236626
2-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid (PubChem CID 23236626) has the molecular formula C8H8F9NO4S and a molecular weight of 385.20 g/mol. Its IUPAC name is 2-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid.
| Compound Name | 2-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 23236626 |
| Molecular Formula | C8H8F9NO4S |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | 2-methyl-2-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylamino)propanoic acid |
| SMILES | CC(C)(NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H8F9NO4S/c1-4(2,3(19)20)18-23(21,22)8(16,17)6(11,12)5(9,10)7(13,14)15/h18H,1-2H3,(H,19,20) |
| InChIKey | AAZCVKSMEDBFSW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|