C28H20F10O4 — CID 23236690
2-(methoxymethoxy)-1-[2-(methoxymethoxy)-6-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)naphthalene (PubChem CID 23236690) has the molecular formula C28H20F10O4 and a molecular weight of 610.44 g/mol. Its IUPAC name is 2-(methoxymethoxy)-1-[2-(methoxymethoxy)-6-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)naphthalene.
| Compound Name | 2-(methoxymethoxy)-1-[2-(methoxymethoxy)-6-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)naphthalene |
|---|---|
| PubChem CID | 23236690 |
| Molecular Formula | C28H20F10O4 |
| Molecular Weight | 610.44 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 2-(methoxymethoxy)-1-[2-(methoxymethoxy)-6-(1,1,2,2,2-pentafluoroethyl)naphthalen-1-yl]-6-(1,1,2,2,2-pentafluoroethyl)naphthalene |
| SMILES | COCOc1ccc2cc(C(F)(F)C(F)(F)F)ccc2c1-c1c(OCOC)ccc2cc(C(F)(F)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C28H20F10O4/c1-39-13-41-21-9-3-15-11-17(25(29,30)27(33,34)35)5-7-19(15)23(21)24-20-8-6-18(26(31,32)28(36,37)38)12-16(20)4-10-22(24)42-14-40-2/h3-12H,13-14H2,1-2H3 |
| InChIKey | VRZJVKGCHQEJTD-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.44 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|