C10H14BrF2NO2 — CID 23236711
ethyl (E)-4-bromo-4,4-difluoro-3-pyrrolidin-1-ylbut-2-enoate (PubChem CID 23236711) has the molecular formula C10H14BrF2NO2 and a molecular weight of 298.13 g/mol. Its IUPAC name is ethyl (E)-4-bromo-4,4-difluoro-3-pyrrolidin-1-ylbut-2-enoate.
| Compound Name | ethyl (E)-4-bromo-4,4-difluoro-3-pyrrolidin-1-ylbut-2-enoate |
|---|---|
| PubChem CID | 23236711 |
| Molecular Formula | C10H14BrF2NO2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | ethyl (E)-4-bromo-4,4-difluoro-3-pyrrolidin-1-ylbut-2-enoate |
| SMILES | CCOC(=O)/C=C(/N1CCCC1)C(F)(F)Br |
| InChI | InChI=1S/C10H14BrF2NO2/c1-2-16-9(15)7-8(10(11,12)13)14-5-3-4-6-14/h7H,2-6H2,1H3/b8-7+ |
| InChIKey | WLUCSOHXNWVOCK-BQYQJAHWSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|