C18H29F5 — CID 23236775
1-(2,2,3,3,3-pentafluoropropyl)-4-(4-propylcyclohexyl)cyclohexane (PubChem CID 23236775) has the molecular formula C18H29F5 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(2,2,3,3,3-pentafluoropropyl)-4-(4-propylcyclohexyl)cyclohexane.
| Compound Name | 1-(2,2,3,3,3-pentafluoropropyl)-4-(4-propylcyclohexyl)cyclohexane |
|---|---|
| PubChem CID | 23236775 |
| Molecular Formula | C18H29F5 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-(2,2,3,3,3-pentafluoropropyl)-4-(4-propylcyclohexyl)cyclohexane |
| SMILES | CCCC1CCC(C2CCC(CC(F)(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C18H29F5/c1-2-3-13-4-8-15(9-5-13)16-10-6-14(7-11-16)12-17(19,20)18(21,22)23/h13-16H,2-12H2,1H3 |
| InChIKey | JEFBVXRMJVGNTF-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|