C17H19ClF2O5S — CID 23236828
[(2S,3S,4S,5S,6S)-4-acetyloxy-5-[chloro(difluoro)methyl]-2-methyl-6-phenylsulfanyloxan-3-yl] acetate (PubChem CID 23236828) has the molecular formula C17H19ClF2O5S and a molecular weight of 408.85 g/mol. Its IUPAC name is [(2S,3S,4S,5S,6S)-4-acetyloxy-5-[chloro(difluoro)methyl]-2-methyl-6-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(2S,3S,4S,5S,6S)-4-acetyloxy-5-[chloro(difluoro)methyl]-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 23236828 |
| Molecular Formula | C17H19ClF2O5S |
| Molecular Weight | 408.85 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | [(2S,3S,4S,5S,6S)-4-acetyloxy-5-[chloro(difluoro)methyl]-2-methyl-6-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](C)O[C@@H](Sc2ccccc2)[C@H]1C(F)(F)Cl |
| InChI | InChI=1S/C17H19ClF2O5S/c1-9-14(24-10(2)21)15(25-11(3)22)13(17(18,19)20)16(23-9)26-12-7-5-4-6-8-12/h4-9,13-16H,1-3H3/t9-,13-,14-,15-,16-/m0/s1 |
| InChIKey | OZUKPMIYDLTWAX-MPTSBPTFSA-N |
| XLogP | 3.83 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|