C19H29F2O5PS — CID 23236879
(2R,3R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol (PubChem CID 23236879) has the molecular formula C19H29F2O5PS and a molecular weight of 438.47 g/mol. Its IUPAC name is (2R,3R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol.
| Compound Name | (2R,3R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol |
|---|---|
| PubChem CID | 23236879 |
| Molecular Formula | C19H29F2O5PS |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (2R,3R)-1-diethoxyphosphoryl-1,1-difluoro-6-methyl-3-(4-methylphenyl)sulfinylhept-5-en-2-ol |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H](O)[C@@H](CC=C(C)C)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H29F2O5PS/c1-6-25-27(23,26-7-2)19(20,21)18(22)17(13-8-14(3)4)28(24)16-11-9-15(5)10-12-16/h8-12,17-18,22H,6-7,13H2,1-5H3/t17-,18+,28?/m1/s1 |
| InChIKey | YPIQUCRUUXZYAE-PHJFFFLHSA-N |
| XLogP | 5.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|